C25H21BrN4O7 — CID 135822731
N-[3-[(2E)-2-[1-(5-bromo-2,4-dihydroxyphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135822731) has the molecular formula C25H21BrN4O7 and a molecular weight of 569.37 g/mol. Its IUPAC name is N-[3-[(2E)-2-[1-(5-bromo-2,4-dihydroxyphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[(2E)-2-[1-(5-bromo-2,4-dihydroxyphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135822731 |
| Molecular Formula | C25H21BrN4O7 |
| Molecular Weight | 569.37 g/mol |
| Exact Mass | 568.06 |
| IUPAC Name | N-[3-[(2E)-2-[1-(5-bromo-2,4-dihydroxyphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(C=C(NC(=O)c2ccccc2)C(=O)N/N=C(\C)c2cc(Br)c(O)cc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21BrN4O7/c1-14(17-12-18(26)22(32)13-21(17)31)28-29-25(34)19(27-24(33)16-6-4-3-5-7-16)10-15-8-9-23(37-2)20(11-15)30(35)36/h3-13,31-32H,1-2H3,(H,27,33)(H,29,34)/b19-10?,28-14+ |
| InChIKey | GTURXACOBNRJGC-CHMWUZQESA-N |
| XLogP | 4.09 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.37 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|