C24H19ClN4O5 — CID 92847413
N-[(E)-3-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 92847413) has the molecular formula C24H19ClN4O5 and a molecular weight of 478.89 g/mol. Its IUPAC name is N-[(E)-3-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-3-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 92847413 |
| Molecular Formula | C24H19ClN4O5 |
| Molecular Weight | 478.89 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N-[(E)-3-[(2Z)-2-[(4-chloro-3-nitrophenyl)methylidene]hydrazinyl]-1-(4-methoxyphenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(/NC(=O)c2ccccc2)C(=O)N/N=C\c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C24H19ClN4O5/c1-34-19-10-7-16(8-11-19)13-21(27-23(30)18-5-3-2-4-6-18)24(31)28-26-15-17-9-12-20(25)22(14-17)29(32)33/h2-15H,1H3,(H,27,30)(H,28,31)/b21-13+,26-15- |
| InChIKey | RIIOXYXVGIQRSA-XHIFQUCVSA-N |
| XLogP | 4.18 |
| TPSA | 122.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.89 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|