C26H23ClN4O6 — CID 135545675
N-[(Z)-3-[(2Z)-2-[1-(5-chloro-2-hydroxy-4-methylphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 135545675) has the molecular formula C26H23ClN4O6 and a molecular weight of 522.95 g/mol. Its IUPAC name is N-[(Z)-3-[(2Z)-2-[1-(5-chloro-2-hydroxy-4-methylphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[(2Z)-2-[1-(5-chloro-2-hydroxy-4-methylphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 135545675 |
| Molecular Formula | C26H23ClN4O6 |
| Molecular Weight | 522.95 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | N-[(Z)-3-[(2Z)-2-[1-(5-chloro-2-hydroxy-4-methylphenyl)ethylidene]hydrazinyl]-1-(4-methoxy-3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1ccc(/C=C(\NC(=O)c2ccccc2)C(=O)N/N=C(/C)c2cc(Cl)c(C)cc2O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H23ClN4O6/c1-15-11-23(32)19(14-20(15)27)16(2)29-30-26(34)21(28-25(33)18-7-5-4-6-8-18)12-17-9-10-24(37-3)22(13-17)31(35)36/h4-14,32H,1-3H3,(H,28,33)(H,30,34)/b21-12-,29-16- |
| InChIKey | SSRLAIWNUVZCEC-DTVDCRMKSA-N |
| XLogP | 4.58 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.95 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|