C25H18N4O8 — CID 43926689
N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 43926689) has the molecular formula C25H18N4O8 and a molecular weight of 502.44 g/mol. Its IUPAC name is N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 43926689 |
| Molecular Formula | C25H18N4O8 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | N-[(E)-1-(1,3-benzodioxol-5-yl)-3-[(2E)-2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | O=C(N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2)/C(=C\c1ccc2c(c1)OCO2)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H18N4O8/c30-24(16-4-2-1-3-5-16)27-18(8-15-6-7-20-21(9-15)35-13-34-20)25(31)28-26-12-17-10-22-23(37-14-36-22)11-19(17)29(32)33/h1-12H,13-14H2,(H,27,30)(H,28,31)/b18-8+,26-12+ |
| InChIKey | RPOWFEUIQXHFJU-PUAWOXGXSA-N |
| XLogP | 2.97 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|