C27H22N4O6 — CID 2861766
N-[4-methyl-1-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 2861766) has the molecular formula C27H22N4O6 and a molecular weight of 498.50 g/mol. Its IUPAC name is N-[4-methyl-1-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[4-methyl-1-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 2861766 |
| Molecular Formula | C27H22N4O6 |
| Molecular Weight | 498.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[4-methyl-1-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | CC(=Cc1ccccc1)C=C(NC(=O)c1ccccc1)C(=O)NN=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C27H22N4O6/c1-18(12-19-8-4-2-5-9-19)13-22(29-26(32)20-10-6-3-7-11-20)27(33)30-28-16-21-14-24-25(37-17-36-24)15-23(21)31(34)35/h2-16H,17H2,1H3,(H,29,32)(H,30,33) |
| InChIKey | JWPSLLUUDCBWNN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 132.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|