C30H25N5O4 — CID 2859898
N-[4-methyl-1-[2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 2859898) has the molecular formula C30H25N5O4 and a molecular weight of 519.56 g/mol. Its IUPAC name is N-[4-methyl-1-[2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[4-methyl-1-[2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 2859898 |
| Molecular Formula | C30H25N5O4 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | N-[4-methyl-1-[2-[[1-(4-nitrophenyl)pyrrol-2-yl]methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | CC(=Cc1ccccc1)C=C(NC(=O)c1ccccc1)C(=O)NN=Cc1cccn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H25N5O4/c1-22(19-23-9-4-2-5-10-23)20-28(32-29(36)24-11-6-3-7-12-24)30(37)33-31-21-27-13-8-18-34(27)25-14-16-26(17-15-25)35(38)39/h2-21H,1H3,(H,32,36)(H,33,37) |
| InChIKey | CMKHNFZCLXQGQT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|