C26H22ClN5O6 — CID 4204001
2-chloro-N-[1-[4-(dimethylamino)phenyl]-3-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 4204001) has the molecular formula C26H22ClN5O6 and a molecular weight of 535.94 g/mol. Its IUPAC name is 2-chloro-N-[1-[4-(dimethylamino)phenyl]-3-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-[4-(dimethylamino)phenyl]-3-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 4204001 |
| Molecular Formula | C26H22ClN5O6 |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | 2-chloro-N-[1-[4-(dimethylamino)phenyl]-3-[2-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]hydrazinyl]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CN(C)c1ccc(C=C(NC(=O)c2ccccc2Cl)C(=O)NN=Cc2cc3c(cc2[N+](=O)[O-])OCO3)cc1 |
| InChI | InChI=1S/C26H22ClN5O6/c1-31(2)18-9-7-16(8-10-18)11-21(29-25(33)19-5-3-4-6-20(19)27)26(34)30-28-14-17-12-23-24(38-15-37-23)13-22(17)32(35)36/h3-14H,15H2,1-2H3,(H,29,33)(H,30,34) |
| InChIKey | YYFVSQRXNHJUNL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|