C27H24BrN3O4 — CID 135822072
N-[1-[(2E)-2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 135822072) has the molecular formula C27H24BrN3O4 and a molecular weight of 534.41 g/mol. Its IUPAC name is N-[1-[(2E)-2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[1-[(2E)-2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 135822072 |
| Molecular Formula | C27H24BrN3O4 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | N-[1-[(2E)-2-[(5-bromo-3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | CCOc1cc(Br)cc(/C=N/NC(=O)C(=CC=Cc2ccccc2)NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C27H24BrN3O4/c1-2-35-24-17-22(28)16-21(25(24)32)18-29-31-27(34)23(15-9-12-19-10-5-3-6-11-19)30-26(33)20-13-7-4-8-14-20/h3-18,32H,2H2,1H3,(H,30,33)(H,31,34)/b12-9?,23-15?,29-18+ |
| InChIKey | RONGWWOCQJLVJF-DTGDYUMZSA-N |
| XLogP | 5.03 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|