C25H20ClN3O2 — CID 2860711
N-[1-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 2860711) has the molecular formula C25H20ClN3O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is N-[1-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[1-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 2860711 |
| Molecular Formula | C25H20ClN3O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[1-[2-[(4-chlorophenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)C(=CC=Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20ClN3O2/c26-22-16-14-20(15-17-22)18-27-29-25(31)23(13-7-10-19-8-3-1-4-9-19)28-24(30)21-11-5-2-6-12-21/h1-18H,(H,28,30)(H,29,31) |
| InChIKey | MGXWQTWUORMQEL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|