C26H21Br2N3O4 — CID 137206929
N-[(2Z,4E)-1-[2-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 137206929) has the molecular formula C26H21Br2N3O4 and a molecular weight of 599.28 g/mol. Its IUPAC name is N-[(2Z,4E)-1-[2-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4E)-1-[2-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 137206929 |
| Molecular Formula | C26H21Br2N3O4 |
| Molecular Weight | 599.28 g/mol |
| Exact Mass | 596.99 |
| IUPAC Name | N-[(2Z,4E)-1-[2-[(3,5-dibromo-2-hydroxy-4-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | COc1c(Br)cc(C=NNC(=O)/C(=C/C=C/c2ccccc2)NC(=O)c2ccccc2)c(O)c1Br |
| InChI | InChI=1S/C26H21Br2N3O4/c1-35-24-20(27)15-19(23(32)22(24)28)16-29-31-26(34)21(14-8-11-17-9-4-2-5-10-17)30-25(33)18-12-6-3-7-13-18/h2-16,32H,1H3,(H,30,33)(H,31,34)/b11-8+,21-14-,29-16? |
| InChIKey | LURLSKZJNIOUIO-SKEZNJBLSA-N |
| XLogP | 5.40 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|