C27H25N3O5 — CID 135852207
N-[(2Z,4E)-1-[(2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 135852207) has the molecular formula C27H25N3O5 and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[(2Z,4E)-1-[(2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4E)-1-[(2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 135852207 |
| Molecular Formula | C27H25N3O5 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[(2Z,4E)-1-[(2E)-2-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | COc1cc(/C=N/NC(=O)/C(=C/C=C/c2ccccc2)NC(=O)c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C27H25N3O5/c1-34-23-16-20(17-24(35-2)25(23)31)18-28-30-27(33)22(15-9-12-19-10-5-3-6-11-19)29-26(32)21-13-7-4-8-14-21/h3-18,31H,1-2H3,(H,29,32)(H,30,33)/b12-9+,22-15-,28-18+ |
| InChIKey | ZCQLIGYVFAHACI-LVQIGDTLSA-N |
| XLogP | 3.89 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|