C23H19N3O2S — CID 2861022
N-[1-oxo-5-phenyl-1-[2-(thiophen-2-ylmethylidene)hydrazinyl]penta-2,4-dien-2-yl]benzamide (PubChem CID 2861022) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[1-oxo-5-phenyl-1-[2-(thiophen-2-ylmethylidene)hydrazinyl]penta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[1-oxo-5-phenyl-1-[2-(thiophen-2-ylmethylidene)hydrazinyl]penta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 2861022 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[1-oxo-5-phenyl-1-[2-(thiophen-2-ylmethylidene)hydrazinyl]penta-2,4-dien-2-yl]benzamide |
| SMILES | O=C(NN=Cc1cccs1)C(=CC=Cc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O2S/c27-22(19-12-5-2-6-13-19)25-21(15-7-11-18-9-3-1-4-10-18)23(28)26-24-17-20-14-8-16-29-20/h1-17H,(H,25,27)(H,26,28) |
| InChIKey | UPECTHKVVPFIKH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|