C26H21Br2N3O3 — CID 5342136
N-[(2Z,4E)-1-[(2E)-2-[(3,5-dibromo-2-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 5342136) has the molecular formula C26H21Br2N3O3 and a molecular weight of 583.28 g/mol. Its IUPAC name is N-[(2Z,4E)-1-[(2E)-2-[(3,5-dibromo-2-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4E)-1-[(2E)-2-[(3,5-dibromo-2-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 5342136 |
| Molecular Formula | C26H21Br2N3O3 |
| Molecular Weight | 583.28 g/mol |
| Exact Mass | 580.99 |
| IUPAC Name | N-[(2Z,4E)-1-[(2E)-2-[(3,5-dibromo-2-methoxyphenyl)methylidene]hydrazinyl]-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | COc1c(Br)cc(Br)cc1/C=N/NC(=O)/C(=C/C=C/c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21Br2N3O3/c1-34-24-20(15-21(27)16-22(24)28)17-29-31-26(33)23(14-8-11-18-9-4-2-5-10-18)30-25(32)19-12-6-3-7-13-19/h2-17H,1H3,(H,30,32)(H,31,33)/b11-8+,23-14-,29-17+ |
| InChIKey | GJWFFYVLNIVRHJ-PPYKOXEJSA-N |
| XLogP | 5.70 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.28 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|