C16H14Br2N2O3 — CID 110505804
N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-methoxybenzamide (PubChem CID 110505804) has the molecular formula C16H14Br2N2O3 and a molecular weight of 442.11 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-methoxybenzamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-methoxybenzamide |
|---|---|
| PubChem CID | 110505804 |
| Molecular Formula | C16H14Br2N2O3 |
| Molecular Weight | 442.11 g/mol |
| Exact Mass | 439.94 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N/N=C/c1cc(Br)cc(Br)c1OC |
| InChI | InChI=1S/C16H14Br2N2O3/c1-22-14-6-4-3-5-12(14)16(21)20-19-9-10-7-11(17)8-13(18)15(10)23-2/h3-9H,1-2H3,(H,20,21)/b19-9+ |
| InChIKey | JXEUCBSPWHKYGC-DJKKODMXSA-N |
| XLogP | 3.99 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.11 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|