C19H18Br2N2O4 — CID 126323011
N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide (PubChem CID 126323011) has the molecular formula C19H18Br2N2O4 and a molecular weight of 498.17 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide.
| Compound Name | N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 126323011 |
| Molecular Formula | C19H18Br2N2O4 |
| Molecular Weight | 498.17 g/mol |
| Exact Mass | 495.96 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2-methoxyphenyl)methylideneamino]-3-methoxy-4-prop-2-enoxybenzamide |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Br)cc(Br)c2OC)cc1OC |
| InChI | InChI=1S/C19H18Br2N2O4/c1-4-7-27-16-6-5-12(9-17(16)25-2)19(24)23-22-11-13-8-14(20)10-15(21)18(13)26-3/h4-6,8-11H,1,7H2,2-3H3,(H,23,24)/b22-11+ |
| InChIKey | RHZGRZYHSALXFD-SSDVNMTOSA-N |
| XLogP | 4.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|