C20H18Br2N2O6 — CID 126323493
2-[2,6-dibromo-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 126323493) has the molecular formula C20H18Br2N2O6 and a molecular weight of 542.18 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126323493 |
| Molecular Formula | C20H18Br2N2O6 |
| Molecular Weight | 542.18 g/mol |
| Exact Mass | 539.95 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Br)c(OCC(=O)O)c(Br)c2)cc1OC |
| InChI | InChI=1S/C20H18Br2N2O6/c1-3-6-29-16-5-4-13(9-17(16)28-2)20(27)24-23-10-12-7-14(21)19(15(22)8-12)30-11-18(25)26/h3-5,7-10H,1,6,11H2,2H3,(H,24,27)(H,25,26)/b23-10+ |
| InChIKey | PCGVUCXRWVLVNA-AUEPDCJTSA-N |
| XLogP | 4.01 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.18 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|