C25H23BrN2O6S — CID 126325803
[4-bromo-2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126325803) has the molecular formula C25H23BrN2O6S and a molecular weight of 559.44 g/mol. Its IUPAC name is [4-bromo-2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-bromo-2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126325803 |
| Molecular Formula | C25H23BrN2O6S |
| Molecular Weight | 559.44 g/mol |
| Exact Mass | 558.05 |
| IUPAC Name | [4-bromo-2-[(E)-[(3-methoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Br)ccc2OS(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C25H23BrN2O6S/c1-4-13-33-23-11-7-18(15-24(23)32-3)25(29)28-27-16-19-14-20(26)8-12-22(19)34-35(30,31)21-9-5-17(2)6-10-21/h4-12,14-16H,1,13H2,2-3H3,(H,28,29)/b27-16+ |
| InChIKey | JUAFORQMRJJLPC-JVWAILMASA-N |
| XLogP | 4.86 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|