C24H23BrN2O6S — CID 126326869
[4-bromo-2-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126326869) has the molecular formula C24H23BrN2O6S and a molecular weight of 547.43 g/mol. Its IUPAC name is [4-bromo-2-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [4-bromo-2-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126326869 |
| Molecular Formula | C24H23BrN2O6S |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | [4-bromo-2-[(E)-[(3,4-diethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | CCOc1ccc(C(=O)N/N=C/c2cc(Br)ccc2OS(=O)(=O)c2ccccc2)cc1OCC |
| InChI | InChI=1S/C24H23BrN2O6S/c1-3-31-22-12-10-17(15-23(22)32-4-2)24(28)27-26-16-18-14-19(25)11-13-21(18)33-34(29,30)20-8-6-5-7-9-20/h5-16H,3-4H2,1-2H3,(H,27,28)/b26-16+ |
| InChIKey | DVXXVFUUFWOSCW-WGOQTCKBSA-N |
| XLogP | 4.78 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|