C21H16BrClN2O4S — CID 3695723
[4-bromo-2-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 3695723) has the molecular formula C21H16BrClN2O4S and a molecular weight of 507.79 g/mol. Its IUPAC name is [4-bromo-2-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-bromo-2-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 3695723 |
| Molecular Formula | C21H16BrClN2O4S |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 505.97 |
| IUPAC Name | [4-bromo-2-[[(3-chlorobenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Br)cc2C=NNC(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C21H16BrClN2O4S/c1-14-5-8-19(9-6-14)30(27,28)29-20-10-7-17(22)11-16(20)13-24-25-21(26)15-3-2-4-18(23)12-15/h2-13H,1H3,(H,25,26) |
| InChIKey | BLGFACMUCLCNHN-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|