C26H25ClN2O6S — CID 126336966
[4-chloro-2-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126336966) has the molecular formula C26H25ClN2O6S and a molecular weight of 529.01 g/mol. Its IUPAC name is [4-chloro-2-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-chloro-2-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126336966 |
| Molecular Formula | C26H25ClN2O6S |
| Molecular Weight | 529.01 g/mol |
| Exact Mass | 528.11 |
| IUPAC Name | [4-chloro-2-[(E)-[(3-ethoxy-4-prop-2-enoxybenzoyl)hydrazinylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | C=CCOc1ccc(C(=O)N/N=C/c2cc(Cl)ccc2OS(=O)(=O)c2ccc(C)cc2)cc1OCC |
| InChI | InChI=1S/C26H25ClN2O6S/c1-4-14-34-24-12-8-19(16-25(24)33-5-2)26(30)29-28-17-20-15-21(27)9-13-23(20)35-36(31,32)22-10-6-18(3)7-11-22/h4,6-13,15-17H,1,5,14H2,2-3H3,(H,29,30)/b28-17+ |
| InChIKey | BOCKWVQFWCUPGZ-OGLMXYFKSA-N |
| XLogP | 5.14 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.01 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|