About [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate
[4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126081877) has the molecular formula C13H9BrClNO4S
and a molecular weight of 390.64 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate.
Molecular Properties
| Compound Name | [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate |
| PubChem CID | 126081877 |
| Molecular Formula | C13H9BrClNO4S |
| Molecular Weight | 390.64 g/mol |
| Exact Mass | 388.91 |
| IUPAC Name | [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(Br)cc1/C=N\O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H9BrClNO4S/c14-10-1-6-13(9(7-10)8-16-17)20-21(18,19)12-4-2-11(15)3-5-12/h1-8,17H/b16-8- |
| InChIKey | WNICYSOZZZGSKB-PXNMLYILSA-N |
| XLogP | 3.68 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.64 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate?
The IUPAC name of [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate (CID 126081877) is [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate.
What is the SMILES notation for [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate?
The canonical SMILES for [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate is O=S(=O)(Oc1ccc(Br)cc1/C=N\O)c1ccc(Cl)cc1.
What is the InChIKey of [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate?
The InChIKey is WNICYSOZZZGSKB-PXNMLYILSA-N. The full InChI is InChI=1S/C13H9BrClNO4S/c14-10-1-6-13(9(7-10)8-16-17)20-21(18,19)12-4-2-11(15)3-5-12/h1-8,17H/b16-8-.
What are the key properties of [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate?
[4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate has a molecular weight of 390.64 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-bromo-2-[(Z)-hydroxyiminomethyl]phenyl] 4-chlorobenzenesulfonate is sourced from PubChem (CID 126081877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).