C17H10BrClN2O5S2 — CID 126076938
[4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126076938) has the molecular formula C17H10BrClN2O5S2 and a molecular weight of 501.77 g/mol. Its IUPAC name is [4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126076938 |
| Molecular Formula | C17H10BrClN2O5S2 |
| Molecular Weight | 501.77 g/mol |
| Exact Mass | 499.89 |
| IUPAC Name | [4-bromo-2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1cc(Br)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H10BrClN2O5S2/c18-10-1-6-14(26-28(24,25)12-4-2-11(19)3-5-12)9(7-10)8-13-15(22)20-17(27)21-16(13)23/h1-8H,(H2,20,21,22,23,27) |
| InChIKey | ZORXKINUOZCYKN-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|