C22H14BrNO5S — CID 126090044
[4-bromo-2-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate (PubChem CID 126090044) has the molecular formula C22H14BrNO5S and a molecular weight of 484.33 g/mol. Its IUPAC name is [4-bromo-2-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate.
| Compound Name | [4-bromo-2-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126090044 |
| Molecular Formula | C22H14BrNO5S |
| Molecular Weight | 484.33 g/mol |
| Exact Mass | 482.98 |
| IUPAC Name | [4-bromo-2-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] benzenesulfonate |
| SMILES | O=C1ON=C(c2ccccc2)/C1=C/c1cc(Br)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H14BrNO5S/c23-17-11-12-20(29-30(26,27)18-9-5-2-6-10-18)16(13-17)14-19-21(24-28-22(19)25)15-7-3-1-4-8-15/h1-14H/b19-14- |
| InChIKey | UEWRTRYPDMTCQV-RGEXLXHISA-N |
| XLogP | 4.56 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|