C17H11Cl2NO5S — CID 126094573
[4-chloro-2-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126094573) has the molecular formula C17H11Cl2NO5S and a molecular weight of 412.25 g/mol. Its IUPAC name is [4-chloro-2-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-chloro-2-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126094573 |
| Molecular Formula | C17H11Cl2NO5S |
| Molecular Weight | 412.25 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | [4-chloro-2-[(Z)-(3-methyl-5-oxo-1,2-oxazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CC1=NOC(=O)/C1=C\c1cc(Cl)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H11Cl2NO5S/c1-10-15(17(21)24-20-10)9-11-8-13(19)4-7-16(11)25-26(22,23)14-5-2-12(18)3-6-14/h2-9H,1H3/b15-9- |
| InChIKey | WEFSNAKCZUDQJG-DHDCSXOGSA-N |
| XLogP | 4.08 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|