C23H16ClNO5S — CID 126083256
[2-chloro-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126083256) has the molecular formula C23H16ClNO5S and a molecular weight of 453.90 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-chloro-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126083256 |
| Molecular Formula | C23H16ClNO5S |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | [2-chloro-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=C3\C(=O)ON=C3c3ccccc3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H16ClNO5S/c1-15-7-10-18(11-8-15)31(27,28)30-21-12-9-16(14-20(21)24)13-19-22(25-29-23(19)26)17-5-3-2-4-6-17/h2-14H,1H3/b19-13- |
| InChIKey | BTAHLMWYCUSJOP-UYRXBGFRSA-N |
| XLogP | 4.76 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|