C29H21ClN2O5S — CID 126083463
[2-methoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126083463) has the molecular formula C29H21ClN2O5S and a molecular weight of 545.02 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126083463 |
| Molecular Formula | C29H21ClN2O5S |
| Molecular Weight | 545.02 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | [2-methoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H21ClN2O5S/c1-36-27-19-20(12-17-26(27)37-38(34,35)24-15-13-22(30)14-16-24)18-25-28(21-8-4-2-5-9-21)31-32(29(25)33)23-10-6-3-7-11-23/h2-19H,1H3/b25-18- |
| InChIKey | CWAFJIITDCICOS-BWAHOGKJSA-N |
| XLogP | 5.95 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.02 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|