C24H17Cl3N2O4 — CID 135717838
(4Z)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-phenyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one (PubChem CID 135717838) has the molecular formula C24H17Cl3N2O4 and a molecular weight of 503.77 g/mol. Its IUPAC name is (4Z)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-phenyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-phenyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 135717838 |
| Molecular Formula | C24H17Cl3N2O4 |
| Molecular Weight | 503.77 g/mol |
| Exact Mass | 502.03 |
| IUPAC Name | (4Z)-4-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-5-phenyl-2-(2,4,6-trichlorophenyl)pyrazol-3-one |
| SMILES | COc1cc(/C=C2\C(=O)N(c3c(Cl)cc(Cl)cc3Cl)N=C2c2ccccc2)cc(OC)c1O |
| InChI | InChI=1S/C24H17Cl3N2O4/c1-32-19-9-13(10-20(33-2)23(19)30)8-16-21(14-6-4-3-5-7-14)28-29(24(16)31)22-17(26)11-15(25)12-18(22)27/h3-12,30H,1-2H3/b16-8- |
| InChIKey | RRTFIPRSMILXKB-PXNMLYILSA-N |
| XLogP | 6.20 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.77 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|