C25H22N2O3 — CID 6289464
(4Z)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 6289464) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is (4Z)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 6289464 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | (4Z)-4-[(3-ethoxy-4-methoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)ccc1OC |
| InChI | InChI=1S/C25H22N2O3/c1-3-30-23-17-18(14-15-22(23)29-2)16-21-24(19-10-6-4-7-11-19)26-27(25(21)28)20-12-8-5-9-13-20/h4-17H,3H2,1-2H3/b21-16- |
| InChIKey | OKOBYKRLYUCKRP-PGMHBOJBSA-N |
| XLogP | 4.93 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|