C26H23BrN2O3 — CID 126084963
(4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 126084963) has the molecular formula C26H23BrN2O3 and a molecular weight of 491.39 g/mol. Its IUPAC name is (4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 126084963 |
| Molecular Formula | C26H23BrN2O3 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | (4Z)-4-[(3-bromo-5-methoxy-4-propoxyphenyl)methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | CCCOc1c(Br)cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc1OC |
| InChI | InChI=1S/C26H23BrN2O3/c1-3-14-32-25-22(27)16-18(17-23(25)31-2)15-21-24(19-10-6-4-7-11-19)28-29(26(21)30)20-12-8-5-9-13-20/h4-13,15-17H,3,14H2,1-2H3/b21-15- |
| InChIKey | IZJULGIWOYTFTQ-QNGOZBTKSA-N |
| XLogP | 6.08 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|