C32H25BrN2O5 — CID 126087230
4-[[2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 126087230) has the molecular formula C32H25BrN2O5 and a molecular weight of 597.47 g/mol. Its IUPAC name is 4-[[2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126087230 |
| Molecular Formula | C32H25BrN2O5 |
| Molecular Weight | 597.47 g/mol |
| Exact Mass | 596.09 |
| IUPAC Name | 4-[[2-bromo-6-ethoxy-4-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C32H25BrN2O5/c1-2-39-28-19-22(18-27(33)30(28)40-20-21-13-15-24(16-14-21)32(37)38)17-26-29(23-9-5-3-6-10-23)34-35(31(26)36)25-11-7-4-8-12-25/h3-19H,2,20H2,1H3,(H,37,38)/b26-17- |
| InChIKey | ODVZOPJWFCZWPI-ONUIUJJFSA-N |
| XLogP | 6.96 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.47 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|