C31H24FIN2O3 — CID 126093706
(4Z)-4-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 126093706) has the molecular formula C31H24FIN2O3 and a molecular weight of 618.45 g/mol. Its IUPAC name is (4Z)-4-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4Z)-4-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 126093706 |
| Molecular Formula | C31H24FIN2O3 |
| Molecular Weight | 618.45 g/mol |
| Exact Mass | 618.08 |
| IUPAC Name | (4Z)-4-[[3-ethoxy-4-[(4-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(c3ccccc3)N=C2c2ccccc2)cc(I)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C31H24FIN2O3/c1-2-37-28-19-22(18-27(33)30(28)38-20-21-13-15-24(32)16-14-21)17-26-29(23-9-5-3-6-10-23)34-35(31(26)36)25-11-7-4-8-12-25/h3-19H,2,20H2,1H3/b26-17- |
| InChIKey | YKBRAXNSLQFCLX-ONUIUJJFSA-N |
| XLogP | 7.24 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.45 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|