C25H19FINO4 — CID 126085483
(4Z)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 126085483) has the molecular formula C25H19FINO4 and a molecular weight of 543.33 g/mol. Its IUPAC name is (4Z)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 126085483 |
| Molecular Formula | C25H19FINO4 |
| Molecular Weight | 543.33 g/mol |
| Exact Mass | 543.03 |
| IUPAC Name | (4Z)-4-[[3-ethoxy-4-[(3-fluorophenyl)methoxy]-5-iodophenyl]methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | CCOc1cc(/C=C2\C(=O)ON=C2c2ccccc2)cc(I)c1OCc1cccc(F)c1 |
| InChI | InChI=1S/C25H19FINO4/c1-2-30-22-14-17(12-20-23(28-32-25(20)29)18-8-4-3-5-9-18)13-21(27)24(22)31-15-16-7-6-10-19(26)11-16/h3-14H,2,15H2,1H3/b20-12- |
| InChIKey | JYQKXNCNWYCHDT-NDENLUEZSA-N |
| XLogP | 5.75 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|