C19H14INO6 — CID 126095539
2-[2-iodo-6-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenoxy]acetic acid (PubChem CID 126095539) has the molecular formula C19H14INO6 and a molecular weight of 479.23 g/mol. Its IUPAC name is 2-[2-iodo-6-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-iodo-6-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126095539 |
| Molecular Formula | C19H14INO6 |
| Molecular Weight | 479.23 g/mol |
| Exact Mass | 478.99 |
| IUPAC Name | 2-[2-iodo-6-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]phenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\C(=O)ON=C2c2ccccc2)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C19H14INO6/c1-25-15-9-11(8-14(20)18(15)26-10-16(22)23)7-13-17(21-27-19(13)24)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,22,23)/b13-7- |
| InChIKey | HSZSAJRZLXNQHE-QPEQYQDCSA-N |
| XLogP | 3.11 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|