C26H21NO6S — CID 126084475
[2-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 126084475) has the molecular formula C26H21NO6S and a molecular weight of 475.52 g/mol. Its IUPAC name is [2-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [2-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126084475 |
| Molecular Formula | C26H21NO6S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | [2-methoxy-4-[(Z)-(5-oxo-3-phenyl-1,2-oxazol-4-ylidene)methyl]-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | C=CCc1cc(/C=C2\C(=O)ON=C2c2ccccc2)cc(OC)c1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H21NO6S/c1-3-10-20-15-18(16-22-24(27-32-26(22)28)19-11-6-4-7-12-19)17-23(31-2)25(20)33-34(29,30)21-13-8-5-9-14-21/h3-9,11-17H,1,10H2,2H3/b22-16- |
| InChIKey | GWDXRIQLCZHRTO-JWGURIENSA-N |
| XLogP | 4.54 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|