C28H28N4O5S2 — CID 56687554
[4-[(E)-(2-cyclohexyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate (PubChem CID 56687554) has the molecular formula C28H28N4O5S2 and a molecular weight of 564.69 g/mol. Its IUPAC name is [4-[(E)-(2-cyclohexyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate.
| Compound Name | [4-[(E)-(2-cyclohexyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 56687554 |
| Molecular Formula | C28H28N4O5S2 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | [4-[(E)-(2-cyclohexyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxy-6-prop-2-enylphenyl] benzenesulfonate |
| SMILES | [H]/N=C1C(=C\c2cc(CC=C)c(OS(=O)(=O)c3ccccc3)c(OC)c2)/C(=O)N=C2SC(C3CCCCC3)=NN2/1 |
| InChI | InChI=1S/C28H28N4O5S2/c1-3-10-20-15-18(17-23(36-2)24(20)37-39(34,35)21-13-8-5-9-14-21)16-22-25(29)32-28(30-26(22)33)38-27(31-32)19-11-6-4-7-12-19/h3,5,8-9,13-17,19,29H,1,4,6-7,10-12H2,2H3/b22-16+,29-25- |
| InChIKey | DPUBHHLMOWZTKU-YSKLIXNHSA-N |
| XLogP | 5.39 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|