C28H29IN4O5S — CID 3745615
2-cyclohexyl-5-imino-6-[[3-iodo-5-methoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3745615) has the molecular formula C28H29IN4O5S and a molecular weight of 660.53 g/mol. Its IUPAC name is 2-cyclohexyl-5-imino-6-[[3-iodo-5-methoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 2-cyclohexyl-5-imino-6-[[3-iodo-5-methoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3745615 |
| Molecular Formula | C28H29IN4O5S |
| Molecular Weight | 660.53 g/mol |
| Exact Mass | 660.09 |
| IUPAC Name | 2-cyclohexyl-5-imino-6-[[3-iodo-5-methoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methylidene]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cc(I)c(OCCOc3ccccc3OC)c(OC)c2)C(=O)N=C2SC(C3CCCCC3)=NN21 |
| InChI | InChI=1S/C28H29IN4O5S/c1-35-21-10-6-7-11-22(21)37-12-13-38-24-20(29)15-17(16-23(24)36-2)14-19-25(30)33-28(31-26(19)34)39-27(32-33)18-8-4-3-5-9-18/h6-7,10-11,14-16,18,30H,3-5,8-9,12-13H2,1-2H3/b19-14?,30-25+ |
| InChIKey | IMSJRAVMMWKFHP-ZESAFHDISA-N |
| XLogP | 5.97 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|