C31H33N5O2S — CID 56726752
(6E)-2-cyclohexyl-6-[[1-[3-(2,3-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56726752) has the molecular formula C31H33N5O2S and a molecular weight of 539.71 g/mol. Its IUPAC name is (6E)-2-cyclohexyl-6-[[1-[3-(2,3-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6E)-2-cyclohexyl-6-[[1-[3-(2,3-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56726752 |
| Molecular Formula | C31H33N5O2S |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (6E)-2-cyclohexyl-6-[[1-[3-(2,3-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C\c2cn(CCCOc3cccc(C)c3C)c3ccccc23)/C(=O)N=C2SC(C3CCCCC3)=NN2/1 |
| InChI | InChI=1S/C31H33N5O2S/c1-20-10-8-15-27(21(20)2)38-17-9-16-35-19-23(24-13-6-7-14-26(24)35)18-25-28(32)36-31(33-29(25)37)39-30(34-36)22-11-4-3-5-12-22/h6-8,10,13-15,18-19,22,32H,3-5,9,11-12,16-17H2,1-2H3/b25-18+,32-28- |
| InChIKey | JDWZUAYDACXFDB-NEXLMUQJSA-N |
| XLogP | 6.93 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|