C33H31N5O3S — CID 4977307
6-[[1-[3-(3,4-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4977307) has the molecular formula C33H31N5O3S and a molecular weight of 577.71 g/mol. Its IUPAC name is 6-[[1-[3-(3,4-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-[3-(3,4-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4977307 |
| Molecular Formula | C33H31N5O3S |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 6-[[1-[3-(3,4-dimethylphenoxy)propyl]indol-3-yl]methylidene]-5-imino-2-[(2-methylphenoxy)methyl]-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1/C(=Cc2cn(CCCOc3ccc(C)c(C)c3)c3ccccc23)C(=O)N=C2SC(COc3ccccc3C)=NN21 |
| InChI | InChI=1S/C33H31N5O3S/c1-21-13-14-25(17-23(21)3)40-16-8-15-37-19-24(26-10-5-6-11-28(26)37)18-27-31(34)38-33(35-32(27)39)42-30(36-38)20-41-29-12-7-4-9-22(29)2/h4-7,9-14,17-19,34H,8,15-16,20H2,1-3H3/b27-18?,34-31- |
| InChIKey | GVIDUOGEIMWOSQ-DDMAWPJVSA-N |
| XLogP | 6.73 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|