C30H24ClN5O2S — CID 56727810
(6Z)-2-(2-chlorophenyl)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727810) has the molecular formula C30H24ClN5O2S and a molecular weight of 554.08 g/mol. Its IUPAC name is (6Z)-2-(2-chlorophenyl)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-2-(2-chlorophenyl)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727810 |
| Molecular Formula | C30H24ClN5O2S |
| Molecular Weight | 554.08 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | (6Z)-2-(2-chlorophenyl)-6-[[1-[2-(3,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cn(CCOc3ccc(C)c(C)c3)c3ccccc23)/C(=O)N=C2SC(c3ccccc3Cl)=NN2/1 |
| InChI | InChI=1S/C30H24ClN5O2S/c1-18-11-12-21(15-19(18)2)38-14-13-35-17-20(22-7-4-6-10-26(22)35)16-24-27(32)36-30(33-28(24)37)39-29(34-36)23-8-3-5-9-25(23)31/h3-12,15-17,32H,13-14H2,1-2H3/b24-16-,32-27- |
| InChIKey | MHIYBMGNMVQHJR-DENACCOXSA-N |
| XLogP | 6.66 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.08 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|