C27H16Cl3N5OS — CID 6051038
(6Z)-2-(2-chlorophenyl)-6-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 6051038) has the molecular formula C27H16Cl3N5OS and a molecular weight of 564.89 g/mol. Its IUPAC name is (6Z)-2-(2-chlorophenyl)-6-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-2-(2-chlorophenyl)-6-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 6051038 |
| Molecular Formula | C27H16Cl3N5OS |
| Molecular Weight | 564.89 g/mol |
| Exact Mass | 563.01 |
| IUPAC Name | (6Z)-2-(2-chlorophenyl)-6-[[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cn(Cc3ccc(Cl)cc3Cl)c3ccccc23)/C(=O)N=C2SC(c3ccccc3Cl)=NN2/1 |
| InChI | InChI=1S/C27H16Cl3N5OS/c28-17-10-9-15(22(30)12-17)13-34-14-16(18-5-2-4-8-23(18)34)11-20-24(31)35-27(32-25(20)36)37-26(33-35)19-6-1-3-7-21(19)29/h1-12,14,31H,13H2/b20-11-,31-24- |
| InChIKey | GRYZBFZUAWJBOI-QXFFAMOOSA-N |
| XLogP | 7.32 |
| TPSA | 73.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.89 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|