C26H16Cl2N6OS — CID 56727278
(6Z)-6-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 56727278) has the molecular formula C26H16Cl2N6OS and a molecular weight of 531.43 g/mol. Its IUPAC name is (6Z)-6-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 56727278 |
| Molecular Formula | C26H16Cl2N6OS |
| Molecular Weight | 531.43 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | (6Z)-6-[[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C26H16Cl2N6OS/c27-20-8-7-15(10-21(20)28)13-33-14-17(18-5-1-2-6-22(18)33)11-19-23(29)34-26(31-24(19)35)36-25(32-34)16-4-3-9-30-12-16/h1-12,14,29H,13H2/b19-11-,29-23- |
| InChIKey | QRSJQCBKNDVRGN-SDSSZCQRSA-N |
| XLogP | 6.06 |
| TPSA | 86.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|