C29H24N6O2S — CID 3824527
6-[[1-[2-(2,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3824527) has the molecular formula C29H24N6O2S and a molecular weight of 520.62 g/mol. Its IUPAC name is 6-[[1-[2-(2,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[1-[2-(2,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3824527 |
| Molecular Formula | C29H24N6O2S |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 6-[[1-[2-(2,4-dimethylphenoxy)ethyl]indol-3-yl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2cn(CCOc3ccc(C)cc3C)c3ccccc23)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C29H24N6O2S/c1-18-9-10-25(19(2)14-18)37-13-12-34-17-21(22-7-3-4-8-24(22)34)15-23-26(30)35-29(32-27(23)36)38-28(33-35)20-6-5-11-31-16-20/h3-11,14-17,30H,12-13H2,1-2H3/b23-15?,30-26+ |
| InChIKey | QCEPUNRGKVBGNM-HXYPJGMPSA-N |
| XLogP | 5.40 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|