C28H25N5O3S — CID 2038352
(6Z)-6-[[4-[3-(2,4-dimethylphenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 2038352) has the molecular formula C28H25N5O3S and a molecular weight of 511.61 g/mol. Its IUPAC name is (6Z)-6-[[4-[3-(2,4-dimethylphenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | (6Z)-6-[[4-[3-(2,4-dimethylphenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 2038352 |
| Molecular Formula | C28H25N5O3S |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | (6Z)-6-[[4-[3-(2,4-dimethylphenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1C(=C/c2ccc(OCCCOc3ccc(C)cc3C)cc2)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C28H25N5O3S/c1-18-6-11-24(19(2)15-18)36-14-4-13-35-22-9-7-20(8-10-22)16-23-25(29)33-28(31-26(23)34)37-27(32-33)21-5-3-12-30-17-21/h3,5-12,15-17,29H,4,13-14H2,1-2H3/b23-16-,29-25- |
| InChIKey | JIXCOPOSFHHUMT-DQHRAUICSA-N |
| XLogP | 5.21 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|