C26H20ClN5O3S — CID 3563000
6-[[4-[3-(4-chlorophenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 3563000) has the molecular formula C26H20ClN5O3S and a molecular weight of 518.00 g/mol. Its IUPAC name is 6-[[4-[3-(4-chlorophenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 6-[[4-[3-(4-chlorophenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 3563000 |
| Molecular Formula | C26H20ClN5O3S |
| Molecular Weight | 518.00 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | 6-[[4-[3-(4-chlorophenoxy)propoxy]phenyl]methylidene]-5-imino-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCCCOc3ccc(Cl)cc3)cc2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C26H20ClN5O3S/c27-19-6-10-21(11-7-19)35-14-2-13-34-20-8-4-17(5-9-20)15-22-23(28)32-26(30-24(22)33)36-25(31-32)18-3-1-12-29-16-18/h1,3-12,15-16,28H,2,13-14H2/b22-15?,28-23+ |
| InChIKey | FXEXMSRFANXMJQ-RGFBBTHMSA-N |
| XLogP | 5.25 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.00 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|