C24H13Cl2N5O3S — CID 4669491
[2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-chlorobenzoate (PubChem CID 4669491) has the molecular formula C24H13Cl2N5O3S and a molecular weight of 522.37 g/mol. Its IUPAC name is [2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4669491 |
| Molecular Formula | C24H13Cl2N5O3S |
| Molecular Weight | 522.37 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | [2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]phenyl] 4-chlorobenzoate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OC(=O)c3ccc(Cl)cc3)c(Cl)c2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C24H13Cl2N5O3S/c25-16-6-4-14(5-7-16)23(33)34-19-8-3-13(11-18(19)26)10-17-20(27)31-24(29-21(17)32)35-22(30-31)15-2-1-9-28-12-15/h1-12,27H/b17-10?,27-20+ |
| InChIKey | AYZNNKSMRRQPOF-AJQXSHFPSA-N |
| XLogP | 5.28 |
| TPSA | 108.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.37 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|