C29H25N5O4S — CID 5126299
[4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-tert-butylbenzoate (PubChem CID 5126299) has the molecular formula C29H25N5O4S and a molecular weight of 539.62 g/mol. Its IUPAC name is [4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 5126299 |
| Molecular Formula | C29H25N5O4S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | [4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-tert-butylbenzoate |
| SMILES | [H]/N=C1\C(=Cc2ccc(OC(=O)c3ccc(C(C)(C)C)cc3)c(OC)c2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C29H25N5O4S/c1-29(2,3)20-10-8-18(9-11-20)27(36)38-22-12-7-17(15-23(22)37-4)14-21-24(30)34-28(32-25(21)35)39-26(33-34)19-6-5-13-31-16-19/h5-16,30H,1-4H3/b21-14?,30-24+ |
| InChIKey | PKNMTTUYCGOZQK-IWHGKIFSSA-N |
| XLogP | 5.27 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|