C25H19N5O3S — CID 4680398
5-imino-6-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 4680398) has the molecular formula C25H19N5O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is 5-imino-6-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | 5-imino-6-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 4680398 |
| Molecular Formula | C25H19N5O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 5-imino-6-[(3-methoxy-4-phenylmethoxyphenyl)methylidene]-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | [H]/N=C1\C(=Cc2ccc(OCc3ccccc3)c(OC)c2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C25H19N5O3S/c1-32-21-13-17(9-10-20(21)33-15-16-6-3-2-4-7-16)12-19-22(26)30-25(28-23(19)31)34-24(29-30)18-8-5-11-27-14-18/h2-14,26H,15H2,1H3/b19-12?,26-22+ |
| InChIKey | MYCOSCDLPLGARE-HUSVWTDCSA-N |
| XLogP | 4.34 |
| TPSA | 100.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|