C25H16FN5O4S — CID 2008899
[4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 2008899) has the molecular formula C25H16FN5O4S and a molecular weight of 501.50 g/mol. Its IUPAC name is [4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2008899 |
| Molecular Formula | C25H16FN5O4S |
| Molecular Weight | 501.50 g/mol |
| Exact Mass | 501.09 |
| IUPAC Name | [4-[(Z)-(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | [H]/N=C1C(=C/c2ccc(OC(=O)c3ccc(F)cc3)c(OC)c2)/C(=O)N=C2SC(c3cccnc3)=NN2/1 |
| InChI | InChI=1S/C25H16FN5O4S/c1-34-20-12-14(4-9-19(20)35-24(33)15-5-7-17(26)8-6-15)11-18-21(27)31-25(29-22(18)32)36-23(30-31)16-3-2-10-28-13-16/h2-13,27H,1H3/b18-11-,27-21- |
| InChIKey | BADUDYGZHIMOKA-PODBRPKXSA-N |
| XLogP | 4.12 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|