C25H15ClFN5O4S — CID 4563392
[2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate (PubChem CID 4563392) has the molecular formula C25H15ClFN5O4S and a molecular weight of 535.94 g/mol. Its IUPAC name is [2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 4563392 |
| Molecular Formula | C25H15ClFN5O4S |
| Molecular Weight | 535.94 g/mol |
| Exact Mass | 535.05 |
| IUPAC Name | [2-chloro-4-[(5-imino-7-oxo-2-pyridin-3-yl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-fluorobenzoate |
| SMILES | [H]/N=C1\C(=Cc2cc(Cl)c(OC(=O)c3ccc(F)cc3)c(OC)c2)C(=O)N=C2SC(c3cccnc3)=NN21 |
| InChI | InChI=1S/C25H15ClFN5O4S/c1-35-19-11-13(10-18(26)20(19)36-24(34)14-4-6-16(27)7-5-14)9-17-21(28)32-25(30-22(17)33)37-23(31-32)15-3-2-8-29-12-15/h2-12,28H,1H3/b17-9?,28-21+ |
| InChIKey | BOOPZRRFEPKJSU-FWMHZUHISA-N |
| XLogP | 4.77 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.94 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|