C23H19ClN4O6S2 — CID 56727238
[2-chloro-4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate (PubChem CID 56727238) has the molecular formula C23H19ClN4O6S2 and a molecular weight of 547.01 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [2-chloro-4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 56727238 |
| Molecular Formula | C23H19ClN4O6S2 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | [2-chloro-4-[(Z)-(2-ethylsulfonyl-5-imino-7-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-6-ylidene)methyl]-6-methoxyphenyl] 4-methylbenzoate |
| SMILES | [H]/N=C1C(=C/c2cc(Cl)c(OC(=O)c3ccc(C)cc3)c(OC)c2)/C(=O)N=C2SC(S(=O)(=O)CC)=NN2/1 |
| InChI | InChI=1S/C23H19ClN4O6S2/c1-4-36(31,32)23-27-28-19(25)15(20(29)26-22(28)35-23)9-13-10-16(24)18(17(11-13)33-3)34-21(30)14-7-5-12(2)6-8-14/h5-11,25H,4H2,1-3H3/b15-9-,25-19- |
| InChIKey | UVYAZMBIMCYSRO-NJNWROQLSA-N |
| XLogP | 3.89 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|